| Supplier Name | Wanyin (Hebei) new material technology Co., Ltd |
| Tel | |
| Mobile | 13013270101 |
| wanyinhuagong@163.com | |
| Website | http://hbwanyin.com |
| Product Name | Hydantoin |
| Synonyms | Hydantoin HYDANTOIN GLYCOLYLUREA imidazole-2,4-dione 2.4-Imidazolinedione 2,4-IMIDAZOLINEDIONE 2,4-IMIDAZOLIDINEDIONE |
| CAS | 461-72-3 |
| EINECS | 207-313-3 |
| Chemical Formula | C3H4N2O2 |
| Molecular Weight | 100.08 |
| inchi | InChI=1/C3H2N2O2/c6-2-1-4-3(7)5-2/h1H,(H,5,6,7) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |