| Supplier Name | Henan Research New Material Co., Ltd |
| Tel | |
| Mobile | +86 18137458807 |
| sales021@researchvip.com | |
| Website | http://www.researchvip.com |
| Product Name | 6,6'-diphenylfulvene |
| Synonyms | DIPHENYLFULVENE 6,6-DIPHENYLFULVENE 6,6'-diphenylfulvene 6,6'-DIPHENYLFULVENE Fulvene, 6,6-diphenyl Diphenylmethylidene cyclopentadiene 5-(DIPHENYLMETHYLENE)-1,3-CYCLOPENTADIENE |
| CAS | 2175-90-8 |
| EINECS | 218-533-4 |
| Chemical Formula | C18H14 |
| Molecular Weight | 230.3 |
| inchi | InChI=1/C18H14/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16/h1-14H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |