| Supplier Name | Henan Research New Material Co., Ltd |
| Tel | |
| Mobile | +86 18137458807 |
| sales021@researchvip.com | |
| Website | http://www.researchvip.com |
| Product Name | 2-Dodecen-1-ylsuccinic anhydride |
| Synonyms | TPSA 2,5-Furandione, 3-dodecenyl- TETRAPROPENYLSUCCINIC ANHYDRIDE 2-Dodecen-1-ylsuccinic anhydride 3-(2-dodecenyl)succinic anhydride (2-Dodecen-1-yl)succinic anhydride 3-(2-dodecenyl)dihydro-5-furandione |
| CAS | 19780-11-1 |
| EINECS | 243-296-9 |
| Chemical Formula | C16H26O3 |
| Molecular Weight | 266.38 |
| inchi | InChI=1/C16H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18/h10-11,14H,2-9,12-13H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |