| Supplier Name | Hebei huafan biology science and technology co., ltd |
| Tel | |
| Mobile | 15030876788 |
| Website | http://hebeihuafan.com |
| Product Name | L-Cysteine hydrochloride anhydrous |
| Synonyms | L-β-mercapto H-Cys-OH.HCl L-Cysteine HCl L-Cysteine hydrochlo L-Cysteine Hcl Anhydrous L-Cysteine hydrochloride L-Cysteine HCl anhydrate |
| CAS | 52-89-1 |
| EINECS | 200-157-7 |
| Chemical Formula | C3H8ClNO2S |
| Molecular Weight | 157.62 |
| inchi | InChI=1/C3H7NO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H/p-1 |
| Package | 25kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |