| Supplier Name | Hebei huafan biology science and technology co., ltd |
| Tel | |
| Mobile | 15030876788 |
| Website | http://hebeihuafan.com |
| Product Name | L(+)-Lysine monohydrochloride |
| Synonyms | 233-234-9 H-Lys-OH*HCl H-Lys-OH·HCl L-Lysine HCl H-Lys-OH.HCl (L-lysinesalt) L-Lysine Hcl Mono |
| CAS | 657-27-2;10098-89-2 |
| EINECS | 211-519-9;233-234-9 |
| Chemical Formula | C6H14N2O2.HCl |
| Molecular Weight | 182.65 |
| inchi | InChI=1/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H |
| Package | 25kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |