| Supplier Name | |
| Tel | 0519-86461196/0519-86464994 |
| Mobile | |
| gxx@xingshengtech.com, gxy@xingshengtech.com, xp@xingshengtech.com | |
| Website | http://www.sd-xingshun.com |
| Product Name | Methyl 6-bromo-2-naphthoate |
| Synonyms | Methyl-6-bromo-2-naphtoate METHYL 6-BROMO-2-NAPHTHOATE Methyl 6-bromo-2-naphthoate 2-Bromo-6-naphthoic acid methylester 6-Bromo-2-Naphtoic Acid Methyl Ester 6-Bromo-2-naphthoic acid methyl ester |
| CAS | 33626-98-1 |
| EINECS | 608-896-0 |
| Chemical Formula | C12H9BrO2 |
| Molecular Weight | 265.1 |
| inchi | InChI=1/C12H9BrO2/c1-15-12(14)10-3-2-9-7-11(13)5-4-8(9)6-10/h2-7H,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |