| Supplier Name | |
| Tel | 0519-86461196/0519-86464994 |
| Mobile | |
| gxx@xingshengtech.com, gxy@xingshengtech.com, xp@xingshengtech.com | |
| Website | http://www.sd-xingshun.com |
| Product Name | 4-Bromo Phthalic anhydride |
| Synonyms | Timtec-Bb Sbb008534 4-Bromophthal Anhydride 4-Bromophtalic Anhydride 4-BROMO PHTHALIC ANHYDRUS 4-Bromo Phthalic anhydride 4-Bromophthalic Acid Anhydride 5-Bromo-2-Benzofuran-1,3-Dione |
| CAS | 86-90-8 |
| EINECS | 201-707-9 |
| Chemical Formula | C8H3BrO3 |
| Molecular Weight | 227.01 |
| inchi | InChI=1/C8H3BrO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |