| Supplier Name | JiangSu 01 Industrial Co., Ltd. |
| Tel | 15105181882 |
| Mobile | 15105181882 |
| mera.z@sunmy.com | |
| Website | http://www.slchem.com |
| Product Name | 3-nitrophthalic acid |
| Synonyms | 3-NPA AKOS B028734 3-nitrophthalic 3-nitrophthalic acid m-Nitrophthalic acid LABOTEST-BB LT01689746 Phthalic acid, 3-nitro- |
| CAS | 603-11-2 |
| EINECS | 210-030-8 |
| Chemical Formula | C8H5NO6 |
| Molecular Weight | 211.13 |
| inchi | InChI=1/C8H5NO6/c10-7(11)4-2-1-3-5(9(14)15)6(4)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |