| Supplier Name | JiangSu 01 Industrial Co., Ltd. |
| Tel | 15105181882 |
| Mobile | 15105181882 |
| mera.z@sunmy.com | |
| Website | http://www.slchem.com |
| Product Name | 4-Nitrophthalonitrile |
| Synonyms | ROXA-012 4-Nitrophthalonitrile 4-nitro-phthalonitril Febuxostat Impurity 11 4-nitro phthalic nitrile 3,4-Dicyano 1-nitrobenzene 4-Nitro-2-benzenedicarbonitrile |
| CAS | 31643-49-9 |
| EINECS | 250-748-9 |
| Chemical Formula | C8H3N3O2 |
| Molecular Weight | 173.13 |
| inchi | InChI=1/C8H3N3O2/c9-4-6-1-2-8(11(12)13)3-7(6)5-10/h1-3H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |