Product Name | (R)-tetrahydrofuran-2-carboxylic acid |
Synonyms | RCTF R-THFC Faropenem,Fropenem (R)-2-TETRAHYDROFUROIC ACID (2R)-oxolane-2-carboxylic acid (R)-(+)-2-Tetrahydrofuroic acid (R)-(+)-2-Tetrahydrofuroic Acid |
CAS | 87392-05-0 |
EINECS | 627-523-2 |
Chemical Formula | C5H8O3 |
Molecular Weight | 116.12 |
inchi | InChI=1/C5H8O3/c6-5(7)4-2-1-3-8-4/h4H,1-3H2,(H,6,7)/t4-/m1/s1 |
Package | 25KG/Drum |
Price | RFQ |
Descriptions | (R) Tetrahydrofuranic acid is an organic compound with the chemical formula C5H4O3 as CAS: 87392-05-0. It is a colorless liquid with an irritating odor. Tetrahydrofuranic acid is an important pharmaceutical and chemical intermediate that can be used to synthesize antibiotics, antiviral drugs, and other bioactive compounds. (R) Tetrahydrofuranic acid has the following characteristics: 1. Biological activity: Tetrahydrofuranic acid and its derivatives have antibacterial, antiviral, anti-tumor and other biological activities, thus having broad application prospects in the pharmaceutical field. 2. Synthesis route: Tetrahydrofuranic acid can be obtained through multiple synthesis routes, such as using threonine as the raw material for synthesis, or by designing and synthesizing derivatives with specific biological activities. 3. Application areas: In addition to the pharmaceutical field, tetrahydrofuran formic acid is also widely used in fields such as pesticides and chemicals as an intermediate to synthesize other active compounds. |
Last Update | 2024-11-05 09:57:44 |