| Supplier Name | |
| Tel | 18589069862 |
| Mobile | 18589069862（同微信） |
| 1158168052@qq.com | |
| Website | http://www.xingkaiyuesw.com/ |
| Product Name | Hydroxyphenylhydantoin |
| Synonyms | RARECHEM AP KH 0026 Hydroxyphenylhydantoin P-Hydroxyphenylhydantoin 4-HYDROXYPHENYL HYDANTOIN 4-Hydroxyphenyl Hydantoin 5-(4-Hydroxyphenyl)hydantoin 5-(4-HYDROXYPHENYL)HYDANTOIN |
| CAS | 2420-17-9;54832-24-5 |
| EINECS | 219-340-8 |
| Chemical Formula | C9H8N2O3 |
| Molecular Weight | 192.17 |
| inchi | InChI=1/C9H8N2O3/c12-6-3-1-5(2-4-6)7-8(13)11-9(14)10-7/h1-4,7,12H,(H2,10,11,13,14) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |