| Supplier Name | Eaglech（shanghai）Pharmaceutical Co., |
| Tel | 021-60290089 |
| Mobile | 18701839918 |
| dshs21@eagle-pharm.com, | |
| Website | http://www.eagle-pharm.com |
| Product Name | (+)-Pilocarpine hydrochloride |
| Synonyms | (3S,4R)- Akarpine AlMocarpin pilocarpine hcl PILOCARPINE HCL(P) PIEFELTARRAENIN IA(SH) Pilocarpin Hydrochloride |
| CAS | 54-71-7 |
| EINECS | 200-212-5 |
| Chemical Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 |
| inchi | InChI=1/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |