| Name | 2,5-Dimethyltetrahydrofuran, mixture of cis and trans |
| Synonyms | 2,5-DIMETHYLTETRAHYDROFURAN Tetrahydro-2,5-dimethylfuran 2,5-Dimethyltetrahydrofurane Furan, tetrahydro-2,5-dimethyl- 2,5-DIMETHYLTETRAHYDROFURAN (STABILZED WITH BHT) 2,5-dimethyltetrahydrofuran,mixtureofcisandtrans 2,5-Dimethyltetrahydrofuran, mixture of cis and trans |
| CAS | 1003-38-9 |
| EINECS | 213-707-6 |
| InChI | InChI=1/C6H12O/c1-5-3-4-6(2)7-5/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| Molecular Formula | C6H12O |
| Molar Mass | 100.16 |
| Density | 0.833g/mLat 25°C(lit.) |
| Melting Point | -128.9°C |
| Boling Point | 90-92°C(lit.) |
| Flash Point | 80°F |
| Water Solubility | Practically insoluble in water |
| Vapor Presure | 62.1mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| BRN | 102563 |
| Storage Condition | Refrigerator |
| Refractive Index | n20/D 1.404(lit.) |
| MDL | MFCD00005369 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 10 - Flammable |
| Safety Description | S16 - Keep away from sources of ignition. S29 - Do not empty into drains. S33 - Take precautionary measures against static discharges. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Class | 3.2 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |