| Name | 3-Phenylpyridine |
| Synonyms | 3-Azabiphenyl Phenylpyridine 3-PHENYLPYRIDINE 3-PhenyIpyridine 3-Phenylpyridine m-Phenylpyridine 3-pyridylbenzene 3-phenyl pyridine PHENYLPYRIDINE(3-) |
| CAS | 1008-88-4 |
| EINECS | 213-762-6 |
| InChI | InChI=1/C11H9N/c1-2-5-10(6-3-1)11-7-4-8-12-9-11/h1-9H |
| InChIKey | HJKGBRPNSJADMB-UHFFFAOYSA-N |
| Molecular Formula | C11H9N |
| Molar Mass | 155.2 |
| Density | 1.082 g/mL at 25 °C (lit.) |
| Melting Point | 164°C |
| Boling Point | 269-270 °C/749 mmHg (lit.) |
| Flash Point | >230°F |
| Solubility | Soluble in chloroform, dichloromethane and ethyl acetate. |
| Vapor Presure | 0.01mmHg at 25°C |
| Appearance | Oil |
| Specific Gravity | 1.082 |
| Color | Clear Colourless |
| BRN | 110400 |
| pKa | 4.85±0.10(Predicted) |
| Storage Condition | Store below +30°C. |
| Refractive Index | n20/D 1.616(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| TSCA | T |
| HS Code | 2933 39 99 |
| Hazard Class | IRRITANT |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | common intermediates in organic synthesis |