| Name | 3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine |
| Synonyms | PDT TIMTEC-BB SBB008869 3-(2-PYRIDYL)-5,6-DIPHENYLTRIAZINE 3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine 5,6-DIPHENYL-3-(2-PYRIDYL)-1,2,4-TRIAZINE 3-(2-PYRIDYL)-5,6-DIPHENYL-1,2,4-TRIAZINE 5,6-diphenyl-3-(pyridin-2-yl)-1,2,4-triazine 5,6-Diphenyl-3-(2-pyridyl)-1,2,4-triazine~PDT 3-(2-PYRIDYL)-5,6-DIPHENYL-1,2,4-TRIAZINE (PDT) |
| CAS | 1046-56-6 |
| EINECS | 213-878-7 |
| InChI | InChI=1/C20H14N4/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)23-24-20(22-18)17-13-7-8-14-21-17/h1-14H |
| Molecular Formula | C20H14N4 |
| Molar Mass | 310.35 |
| Density | 1.2028 (rough estimate) |
| Melting Point | 191-193 °C (lit.) |
| Boling Point | 440.52°C (rough estimate) |
| Flash Point | 237.7°C |
| Water Solubility | Soluble in water. |
| Vapor Presure | 1.33E-10mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light yellow to Yellow to Orange |
| BRN | 542151 |
| pKa | -0.06±0.63(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Stability | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Refractive Index | 1.6400 (estimate) |
| MDL | MFCD00006462 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | XY8598150 |
| TSCA | Yes |
| HS Code | 29336990 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |