| Name | O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranose |
| Synonyms | Maltotriose MALTOTRIOSE, D-(+)-(RG) 4-O-[4-O-(α-D-Glucopyranosyl)-α-D-glucopyranosyl]-D-glucose (+)-4-O-(4-O-α-D-Glucopyranosyl-α-D-glucopyranosyl)-D-glucose O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranosyl-(1→4)-O-α-D-glucopyranose D-Glucose, O-.alpha.-D-glucopyranosyl-(1?4)-O-.alpha.-D-glucopyranosyl-(1?4)- O-α-DD-Glucopyranosyl-(1-4)-O-α-D-glucopyranosyl-(1-4)-D-glucose, α-D-Glc-(1-4)-α-D-Glc-(1-4)-D-Glc 4-[3,4-dihydroxy-6-(hydroxymethyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-oxan-2-yl]oxy-2,3,5,6-tetrahydroxy-hexanal |
| CAS | 1109-28-0 |
| EINECS | 214-174-2 |
| InChI | InChI=1/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16?,17-,18-/m1/s1 |
| InChIKey | FYGDTMLNYKFZSV-DZOUCCHMSA-N |
| Molecular Formula | C18H32O16 |
| Molar Mass | 504.44 |
| Density | 1.4403 (rough estimate) |
| Melting Point | 132-135 °C |
| Boling Point | 513.84°C (rough estimate) |
| Specific Rotation(α) | 160 ° (C=2, H2O) |
| Flash Point | 477°C |
| Water Solubility | Soluble in water. |
| Solubility | Solubility in water: 50 mg/mL, colorless and transparent aqueous solution. |
| Vapor Presure | 6.5E-35mmHg at 25°C |
| Appearance | White powder |
| Color | White to Off-white |
| BRN | 1443481 |
| pKa | 12.39±0.20(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.6760 (estimate) |
| MDL | MFCD00006629 |
| Physical and Chemical Properties | Hydrolysis of the starch exudate of Saccharomyces cerevisiae. Solubility in water: 50 mg/mL, colorless and transparent aqueous solution. Specific rotation [a]20/D :162.5 °(c = 1, H2O). |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10 |
| HS Code | 29400090 |
| Preparation method | In nature, maltose mainly exists in germinated grains, especially malt, so this name is given. Under the action of starch invertase, starch undergoes a hydrolysis reaction to produce maltoglycan, which undergoes a hydrolysis reaction to produce two molecules of glucose. Maltoglycan is a series of low molecular weight sugars obtained by hydrolysis of starch. It is a linear group of α(1-4) linked D-glucose polymers. Usually maltose industrial grade products are made by acidic hydrolysis of potato starch. Maltotriose (Maltotriose) consists of α(1-4) linked D-glucose monomer condensation with a polymerization degree of 3. |
| main uses | food gelatinization, pigment and brittle agent in food processing. Fabric finishing agents are used to increase the weight and stiffness of fabric fibers. Thickeners and adhesives for pharmaceutical and paper coatings. |
| Biological activity | Maltotriose are common oligosaccharide metabolites, which are often found in human urine after ingestion of maltose. |
| use | used for content determination/identification/pharmacological experiments, etc. |