| Name | p-Acetoxycinnamic acid |
| Synonyms | RARECHEM BK HW 0048 P-ACETYLCOUMARIC ACID 4-ACETYLCOUMARIC ACID P-ACETOXYCINNAMIC ACID p-Acetoxycinnamic acid 4-ACETOXYCINNAMIC ACID P-ACETOXY-B-PHENYLACRYLIC ACID P-ACETOXYBENZENEPROPENOIC ACID 3-[4-(acetyloxy)phenyl]prop-2-enoic acid (2Z)-3-[4-(acetyloxy)phenyl]prop-2-enoate (2Z)-3-[4-(acetyloxy)phenyl]prop-2-enoic acid (2E)-3-[4-(acetyloxy)phenyl]prop-2-enoic acid |
| CAS | 15486-19-8 |
| EINECS | 239-512-6 |
| InChI | InChI=1/C11H10O4/c1-8(12)15-10-5-2-9(3-6-10)4-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-4+ |
| Molecular Formula | C11H10O4 |
| Molar Mass | 206.19 |
| Density | 1.267±0.06 g/cm3(Predicted) |
| Melting Point | 205-208°C |
| Boling Point | 209-211 |
| Flash Point | 144.4°C |
| Vapor Presure | 5.51E-06mmHg at 25°C |
| BRN | 2645987 |
| pKa | 4.39±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.592 |
| MDL | MFCD00016847 |
| Physical and Chemical Properties | White crystals. Melting point 203-207 °c. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| TSCA | Yes |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |