| Name | Mesitylene tungsten tricarbonyl |
| Synonyms | TRICARBONYLMESITYLENETUNGSTEN Tricarbonyl(mesitylene)tungsten Mesitylene tungsten tricarbonyl MESITYLENE TUNGSTEN TRICARBONYL Tungsten, tricarbonyl(mesitylene)- Tricarbonyl(eta-mesitylene)tungsten (eta6-1,3,5-Trimethylbenzene) tungsten tricarbonyl tricarbonyl[(1,2,3,4,5,6-eta)-1,3,5-trimethylbenzene]tungsten |
| CAS | 12129-69-0 |
| EINECS | 235-206-1 |
| InChI | InChI=1/C9H12.3CHO.W/c1-7-4-8(2)6-9(3)5-7;3*1-2;/h4-6H,1-3H3;3*2H;/rC12H15O3W/c1-10-7-11(2)9-12(3)8(10)16(7,9,10,11,12,4-13,5-14)6-15/h7-9,13-15H,1-3H3 |
| Molecular Formula | C12H9O3W |
| Molar Mass | 385.04 |
| Melting Point | 214°C (dec.)(lit.) |
| Water Solubility | Insoluble in water. |
| Appearance | crystal |
| Color | yellow |
| Exposure Limit | ACGIH: TWA 3 mg/m3NIOSH: TWA 5 mg/m3; STEL 10 mg/m3 |
| Storage Condition | Room Temprature |
| MDL | MFCD00015319 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 3466 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| Packing Group | II |