| Name | 4-Nitrobenzoyl chloride |
| Synonyms | p-nitrobenzoyl chloride 4-Nitrobenzoyl chloride 4-nitrobenzoic acid chloride |
| CAS | 122-04-3 |
| EINECS | 204-517-4 |
| InChI | InChI=1/C7H4ClNO3/c8-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H |
| Molecular Formula | C7H4ClNO3 |
| Molar Mass | 185.565 |
| Density | 1.453g/cm3 |
| Melting Point | 71.5℃ |
| Boling Point | 277.8°C at 760 mmHg |
| Flash Point | 121.8°C |
| Water Solubility | Decomposes |
| Vapor Presure | 0.00442mmHg at 25°C |
| Refractive Index | 1.589 |
| Physical and Chemical Properties | Melting point 71.5°C boiling point 202-205°C (105 torr) flash point 102°C water-soluble Decomposes |
| Use | For medicine, dyes and Organic synthesis |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| Downstream Products | 4-Aminobenzamide |