| Name | 9-(1H-benzotriazol-1-ylmethyl)-9H-carbazole |
| Synonyms | Benzotriazolylmetylcarbazole 9-(1H-Benzotriazol-1-ylmetyl)-9H-carbazole 9-(1H-Benzotriazol-1-ylmethyl)-9H-carbazole 9-(1H-benzotriazol-1-ylmethyl)-9H-carbazole 9-(1H-BENZOTRIAZOL-1-YLMETHYL)-9H-CARBAZOLE 9-[(1H-Benzotriazole-1-yl)methyl]-9H-carbazole 9-((1H-benzo[d][1,2,3]triazol-1-yl)methyl)-9H-carbazole |
| CAS | 124337-34-4 |
| InChI | InChI=1/C19H14N4/c1-4-10-17-14(7-1)15-8-2-5-11-18(15)22(17)13-23-19-12-6-3-9-16(19)20-21-23/h1-12H,13H2 |
| Molecular Formula | C19H14N4 |
| Molar Mass | 298.34 |
| Density | 1.31g/cm3 |
| Melting Point | 190-193 °C (lit.) |
| Boling Point | 479.8°C at 760 mmHg |
| Flash Point | 243.9°C |
| Vapor Presure | 2.3E-09mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow to Light orange |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.738 |
| MDL | MFCD00216631 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |