| Name | 4,4'-Diantipyrylmethane monohydrate |
| Synonyms | TOSLAB 33092 Diantipyrylmethane DIANTIPYRYLMETHANE DIANTIPYRRYLMETHANE Bisantipyrylmethane 4,4'-DIANTIPYRYLMETHANE Trichachnine monohydrate 4,4-Methylenediantipyrine 4,4'-METHYLENEDIANTIPYRINE 4,4'-Diantipyrylmethane monohydrate 4,4'-methylenebis[1,2-dihydro-1,5-dimethyl-2-phenyl-3h-pyrazol-3-on 4,4'-methylenebis(1,2-dihydro-1,5-dimethyl-2-phenyl)-3H-Pyrazol-3-one 4,4'-methanediylbis(1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one) 4,4'-methanediylbis(1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one) hydrate |
| CAS | 1251-85-0 |
| EINECS | 215-009-7 |
| InChI | InChI=1/C23H24N4O2.H2O/c1-16-20(22(28)26(24(16)3)18-11-7-5-8-12-18)15-21-17(2)25(4)27(23(21)29)19-13-9-6-10-14-19;/h5-14H,15H2,1-4H3;1H2 |
| Molecular Formula | C23H24N4O2 |
| Molar Mass | 388.46 |
| Density | 1.1960 (rough estimate) |
| Melting Point | 156°C (dec.)(lit.) |
| Boling Point | 514.17°C (rough estimate) |
| Flash Point | 298.2°C |
| Water Solubility | 439mg/L(20 ºC) |
| Solubility | Insoluble in water, ether and alkali, soluble in acid, ethanol and chloroform. |
| Vapor Presure | 8.32E-14mmHg at 25°C |
| Appearance | White crystal |
| Color | White |
| BRN | 59702 |
| pKa | 1.26±0.65(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.6500 (estimate) |
| MDL | MFCD00149122 |
| Use | Used as a sensitive reagent for the determination of titanium and iron |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29331990 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| uses | as a sensitive reagent for the determination of titanium and iron as a sensitive developer for the determination of Au3, Ti4, Ir, iron (III), molybdenum, neodymium, uranium (VI), iridium, platinum, rhenium, etc. by spectrophotometry and extraction spectrophotometry. Weighing analysis to determine the precipitation agent of silicon. It can also be used as an extractant for various ions. |