| Name | gossypol-acetic acid |
| Synonyms | AT 101 AT-101 CCRIS 3483 Gossypol acetate Acetate gossypol Cottonseed extract Gossypol acetic acid Gossypol-acetic acid Acetic acid gossypol gossypol-acetic acid GOSSYPOL ACETATE(RG) (±)-Gossypol-acetic aci acetic acid gossypol 12542-36-8 GOSSYPOLACETATE(GOSSYPOL-ACETICACID) 1,1',6,6',7,7'-hexahydroxy-3,3'-dimethyl-5,5'-di(propan-2-yl)-2,2'-binaphthalene-8,8'-dicarbaldehyde Gossypol-acetic acid 1,1',6,6',7,7'-Hexahydroxy-3,3'-dimethyl-5,5'-bis(1-methylethyl)[2,2'-binaphthalene]-8,8'-dicarboxaldehyde-acetic acid |
| CAS | 12542-36-8 |
| EINECS | 623-939-3 |
| InChI | InChI=1/C30H30O8.C2H4O2/c1-11(2)19-15-7-13(5)21(27(35)23(15)17(9-31)25(33)29(19)37)22-14(6)8-16-20(12(3)4)30(38)26(34)18(10-32)24(16)28(22)36;1-2(3)4/h7-12,33-38H,1-6H3;1H3,(H,3,4) |
| InChIKey | NIOHNDKHQHVLKA-UHFFFAOYSA-N |
| Molecular Formula | C32H34O10 |
| Molar Mass | 578.61 |
| Melting Point | 164-168°C |
| Boling Point | 707.9°C at 760 mmHg |
| Flash Point | 395.9°C |
| Solubility | Soluble in water and alkaline solution, insoluble in petroleum ether and chloroform. |
| Vapor Presure | 1.05E-20mmHg at 25°C |
| Appearance | Yellow crystal |
| Color | Yellow to Very Dark Yellow |
| Storage Condition | −20°C |
| MDL | MFCD00058385 |
| Physical and Chemical Properties | From Malvaceae plant grass cotton Gossypium herbaceum l. seed, root bark |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R40 - Limited evidence of a carcinogenic effect |
| Safety Description | S22 - Do not breathe dust. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | MD7360000 |
| HS Code | 29153900 |