| Name | 2,5-Dibromo-3-methylthiophene |
| Synonyms | Einecs 236-147-4 2,5-Dibromo-3-methylthiophene 2,5-DIBROMO-3-METHYLTHIOPHENE Thiophene, 2,5-dibromo-3-methyl- |
| CAS | 13191-36-1 |
| EINECS | 236-147-4 |
| InChI | InChI=1/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
| Molecular Formula | C5H4Br2S |
| Molar Mass | 255.96 |
| Density | 1.974 g/mL at 25 °C |
| Melting Point | 130-132 °C |
| Boling Point | 226-230°C |
| Flash Point | 226-230°C |
| Vapor Presure | 0.101mmHg at 25°C |
| BRN | 108894 |
| Storage Condition | 2-8°C |
| Sensitive | Light Sensitive |
| Refractive Index | 1.6130 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/38 - Irritating to eyes and skin. R41 - Risk of serious damage to eyes R38 - Irritating to the skin R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S39 - Wear eye / face protection. |
| UN IDs | UN 2810 6.1 / PGIII |
| WGK Germany | 3 |
| application | 2,5-dibromo-3-methylthiophene is a heterocyclic derivative, mainly used as a pharmaceutical intermediate. |