| Name | 3-CHLORO-4-NITROPYRIDINE |
| Synonyms | 3-CHLORO-4-NITROPYRIDINE Pyridine, 3-chloro-4-nitro- |
| CAS | 13194-60-0 |
| InChI | InChI=1/C5H3ClN2O2/c6-4-3-7-2-1-5(4)8(9)10/h1-3H |
| Molecular Formula | C5H3ClN2O2 |
| Molar Mass | 158.54 |
| Density | 1.489 |
| Melting Point | 25-26℃ |
| Boling Point | 256℃ |
| Flash Point | 108℃ |
| Vapor Presure | 0.026mmHg at 25°C |
| pKa | -0.97±0.18(Predicted) |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.587 |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| use | 3-chloro -4-nitropyridine can be used as an intermediate in pharmaceutical and chemical synthesis. If 3-chloro -4-nitropyridine is inhaled, please move the patient to fresh air. If the skin is in contact, remove the contaminated clothes, rinse the skin thoroughly with soapy water and clear water, and see a doctor if you feel uncomfortable. |