| Name | (S,S)-2,2'-methylenebis(4-phenyl-2-oxazoline) |
| Synonyms | 2,2'-METHYLENEBIS[(4S)-4-PHENYL-2-OXAZOLINE] (S,S)-2,2'-methylenebis(4-phenyl-2-oxazoline) (S,S)-2,2'-METHYLENEBIS(4-PHENYL-2-OXAZOLINE) 4(S,S)-2,2'-METHYLENEBIS(4-PHENYL-2-OXAZOLINE) Bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)methane Bis((4S)-4,5-dihydro-4-phenyloxazol-2-yl)methane 2,2'-Methylenebis[(4S)-4-phenyl-4,5-dihydro-2-oxazole] 2,2′-Methylenebis[(4S)-4-phenyl-2-oxazoline],(S,S)-2,2′-Methylenebis(4-phenyl-2-oxazoline) |
| CAS | 132098-59-0 |
| InChI | InChI=1/C19H18N2O2/c1-3-7-14(8-4-1)16-12-22-18(20-16)11-19-21-17(13-23-19)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/t16-,17-/m0/s1 |
| Molecular Formula | C19H18N2O2 |
| Molar Mass | 306.36 |
| Density | 1.28g/mLat 25°C(lit.) |
| Boling Point | 131-134°C0.01mm Hg(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 3.6E-08mmHg at 25°C |
| BRN | 4202633 |
| pKa | 4.54±0.70(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | n20/D 1.587 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |