| Name | 6-HYDRAZINONICOTINIC ACID |
| Synonyms | MS-3627 6-Hydrazinicotinic acid HYDRALINK 6-HNA REAGENT 6-HYDRAZINONICOTINIC ACID 6-Hydrazinylnicotinic acid 6-HYDRAZINO-NICOTINIC ACID HYDRALINK(TM) 6-HNA REAGENT 6-hydrazinopyridine-3-carboxylic acid 6-Hydrazino-3-pyridinecarboxylic acid 3-Pyridinecarboxylicacid,6-hydrazino- 6-hydrazinylpyridine-3-carboxylic acid 3-Pyridinecarboxylicacid,6-hydrazino-(9CI) |
| CAS | 133081-24-0 |
| EINECS | 251-156-6 |
| InChI | InChI=1/C6H7N3O2/c7-9-5-2-1-4(3-8-5)6(10)11/h1-3H,7H2,(H,8,9)(H,10,11) |
| Molecular Formula | C6H7N3O2 |
| Molar Mass | 153.14 |
| Density | 1.51±0.1 g/cm3(Predicted) |
| Melting Point | 0°C |
| Boling Point | 0°C |
| Flash Point | 0°C |
| Solubility | Aqueous Base (Slightly, Heated, Sonicated) |
| Vapor Presure | 5.65E-08mmHg at 25°C |
| Appearance | Solid |
| Color | Pale Yellow to Light Yellow |
| pKa | 4.72±0.20(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.71 |
| MDL | MFCD03788692 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| Hazard Class | IRRITANT |