| Name | fmoc-N-methyl-L-isoleucine |
| Synonyms | FMOC-MEILE-OH FMOC-L-MEILE-OH FMOC-N-ME-ILE-OH Fmoc-N-Me-Ile-OH fmoc-N-methyl-L-isoleucine Fmoc-N-methyl-L-isoleucine FMOC-N-METHYL-L-ISOLEUCINE FMOC-N-ALPHA-METHYL-L-ISOLEUCINE N-ALPHA-FMOC-N-ALPHA-METHYL-L-ISOLEUCINE N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-isoleucine N-alpha-(9-fluorenylmethyloxycarbonyl)-N-alpha-Methyl-L-isoleucine (2S,3S)-2-[[9H-fluoren-9-ylmethoxy(oxo)methyl]-methylamino]-3-methylpentanoic acid |
| CAS | 138775-22-1 |
| InChI | InChI=1/C22H25NO4/c1-4-14(2)20(21(24)25)23(3)22(26)27-13-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,14,19-20H,4,13H2,1-3H3,(H,24,25)/t14-,20-/m0/s1 |
| InChIKey | IQIOLCJHRZWOLS-XOBRGWDASA-N |
| Molecular Formula | C22H25NO4 |
| Molar Mass | 367.44 |
| Density | 1.194±0.06 g/cm3(Predicted) |
| Melting Point | 177-183°C |
| Boling Point | 537.3±29.0 °C(Predicted) |
| Flash Point | 278.7°C |
| Vapor Presure | 2.25E-12mmHg at 25°C |
| Appearance | Powder |
| BRN | 7548444 |
| pKa | 3.94±0.22(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.581 |
| MDL | MFCD00153389 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| biological activity | Fmoc-N-Me-Ile-OH can be used for polypeptide synthesis. |