| Name | 1,4-DIBROMO-2-FLUOROBENZENE |
| Synonyms | 2,5-DIBROMO-FLUOROBENZENE 1,4-DIBROMO-2-FLUOROBENZENE 2-FLUORO-4-BROMOBROMOBENZENE |
| CAS | 1435-52-5 |
| EINECS | 629-432-3 |
| InChI | InChI=1/C6H3Br2F/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| Molecular Formula | C6H3Br2F |
| Molar Mass | 253.89 |
| Density | 2.0491 (rough estimate) |
| Melting Point | 33-36 °C (lit.) |
| Boling Point | 216 °C (lit.) |
| Flash Point | 215°F |
| Water Solubility | Insoluble in water. |
| Appearance | White crystalline mass |
| BRN | 3236451 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5770 (estimate) |
| MDL | MFCD00010603 |
| Physical and Chemical Properties | WGK Germany:3 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29039990 |
| Hazard Class | IRRITANT |
| Use | 1,4-dibromo-2-fluorobenzene is an organic intermediate that can be used to prepare aromatic dicarboxylic acid. Aromatic dicarboxylic acid is an important organic raw material, which is widely used in medicine, agriculture, photography, dyes, chemical industry and other fields. It can prepare a variety of medicines, pesticides, photoinitiators, dyes, spices and other substances. |