17329-20-3
(1-Isocyanoethyl)benzene
CAS: 17329-20-3
Molecular Formula: C9H9N
17329-20-3 - Names and Identifiers
| Name | (1-Isocyanoethyl)benzene |
| Synonyms | HANSA ISN-0050 (1-Isocyanoethyl)benzene 1-PHENYLETHYL ISOCYANIDE (1-ISOCYANOETHYL)BENZENE 1,1-ISOCYANOPHENYLETHANE α-Methylbenzyl isocyanide Benzene, (1-isocyanoethyl)- ALPHA-METHYLBENZYL ISOCYANIDE alpha-Methylbenzyl isocyanide(1-Isocyanoethyl)benzene |
| CAS | 17329-20-3 |
| InChI | InChI=1/C9H9N/c1-8(10-2)9-6-4-3-5-7-9/h3-8H,1H3 |
17329-20-3 - Physico-chemical Properties
| Molecular Formula | C9H9N |
| Molar Mass | 131.18 |
| Density | 0.95 |
| Boling Point | 98 °C (13.5018 mmHg) |
| Water Solubility | Insoluble |
| Storage Condition | Refrigerator (+4°C) |
| Refractive Index | 1.507-1.51 |
| Physical and Chemical Properties | Storage Conditions: recigerator (4 ℃) |
17329-20-3 - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| HS Code | 29299000 |
17329-20-3 - Introduction
(1-Isocyanoethyl)benzene is an organic compound with the chemical formula C9H9N. The following is a description of some information about the properties, uses, preparation and safety of the compound:
Nature:
1. Appearance:(1-Isocyanoethyl)benzene is a colorless liquid.
2. Density: its density is 0.965 g/mL.
3. Melting point:(1-Isocyanoethyl)benzene has a melting point of -5°C.
4. Stability: It is relatively stable at room temperature, but avoid prolonged exposure to the sun.
Use:
1. Synthesis: It can be used as an intermediate in organic synthesis and used in the synthesis of various organic compounds.
2. Polymer compound: It can be used as a monomer for polymer compounds, such as the synthesis of polymers.
Method:
The preparation method of (1-Isocyanoethyl)benzene can be achieved by the reaction of methylbenzyl bromide and isonitrile. The specific steps are as follows:
1. The methyl benzyl bromide is heated to react with the isonitrile in an appropriate solvent.
2. Purify the resulting product by distillation or other technical means.
Safety Information:
1. (1-Isocyanoethyl)benzene is a flammable liquid and should avoid contact with fire sources.
2. Use should be careful to avoid direct contact with skin, eyes and respiratory tract.
3. During the operation, appropriate protective equipment should be used, such as laboratory gloves, goggles, protective clothing, etc.
4. In storage and handling, should take the necessary fire prevention measures and ventilation facilities.
5. If leakage occurs, remove the leakage immediately and ensure adequate ventilation.
Nature:
1. Appearance:(1-Isocyanoethyl)benzene is a colorless liquid.
2. Density: its density is 0.965 g/mL.
3. Melting point:(1-Isocyanoethyl)benzene has a melting point of -5°C.
4. Stability: It is relatively stable at room temperature, but avoid prolonged exposure to the sun.
Use:
1. Synthesis: It can be used as an intermediate in organic synthesis and used in the synthesis of various organic compounds.
2. Polymer compound: It can be used as a monomer for polymer compounds, such as the synthesis of polymers.
Method:
The preparation method of (1-Isocyanoethyl)benzene can be achieved by the reaction of methylbenzyl bromide and isonitrile. The specific steps are as follows:
1. The methyl benzyl bromide is heated to react with the isonitrile in an appropriate solvent.
2. Purify the resulting product by distillation or other technical means.
Safety Information:
1. (1-Isocyanoethyl)benzene is a flammable liquid and should avoid contact with fire sources.
2. Use should be careful to avoid direct contact with skin, eyes and respiratory tract.
3. During the operation, appropriate protective equipment should be used, such as laboratory gloves, goggles, protective clothing, etc.
4. In storage and handling, should take the necessary fire prevention measures and ventilation facilities.
5. If leakage occurs, remove the leakage immediately and ensure adequate ventilation.
Last Update：2024-04-10 22:29:15
Supplier List
Spot supply
Product Name: (1-Isocyanoethyl)benzene Request for quotationCAS: 17329-20-3
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: (1-Isocyanoethyl)benzene Visit Supplier Webpage Request for quotationCAS: 17329-20-3
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Product Name: Alpha-Methylbenzyl Isocyanide Visit Supplier Webpage Request for quotation
CAS: 17329-20-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
CAS: 17329-20-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Spot supply
Product Name: (1-Isocyanoethyl)benzene Request for quotationCAS: 17329-20-3
Tel: 400-968-2212
Email: 3623107365@qq.com
Mobile: 18916960931
QQ: 3623107365
Wechat: 18916960931
Spot supply
Product Name: (1-Isocyanoethyl)benzene Visit Supplier Webpage Request for quotationCAS: 17329-20-3
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Product Name: Alpha-Methylbenzyl Isocyanide Visit Supplier Webpage Request for quotation
CAS: 17329-20-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
CAS: 17329-20-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
View History
17329-20-3
58379-85-4
1534-08-3
53561-48-1
1001-52-1
144876-37-9
111060-52-7
31795-93-4
34637-22-4
478677-93-9
58379-85-4
1534-08-3
53561-48-1
1001-52-1
144876-37-9
111060-52-7
31795-93-4
34637-22-4
478677-93-9