| Name | cis-1,2-diaminocyclohexane |
| Synonyms | cis-1,2-Cyclohexandiamine cis-1,2-Cyclohexanediamine CIS-1,2-CYCLOHEXANEDIAMINE cis-1,2-diaminocyclohexane CIS-1,2-DIAMINOCYCLOHEXANE meso-1,2-Cyclohexanediamine 1,2-Cyclohexanediamine, cis- (R)(S)-1,2-Diaminocyclohexane (1R,2S)-1,2-Cyclohexanediamine (1R,2S)-cyclohexane-1,2-diamine |
| CAS | 1436-59-5 |
| EINECS | 205-754-6 |
| InChI | InChI=1/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2/t5-,6+ |
| InChIKey | SSJXIUAHEKJCMH-OLQVQODUSA-N |
| Molecular Formula | C6H14N2 |
| Molar Mass | 114.19 |
| Density | 0.952 g/mL at 25 °C (lit.) |
| Melting Point | 8°C |
| Boling Point | 92-93 °C/18 mmHg (lit.) |
| Flash Point | 161°F |
| Water Solubility | Completely miscible in water |
| Vapor Presure | 0.4 mm Hg ( 20 °C) |
| Appearance | Low Melting Solid |
| Color | Brown |
| pKa | 9.93(at 20℃) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | n20/D 1.493(lit.) |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2735 8/PG 2 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-34 |
| HS Code | 29213000 |
| Hazard Class | 8 |
| Packing Group | II |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |