| Name | 3-(2-Fluorophenyl)propionic acid |
| Synonyms | AKOS BC-2701 2μ-Fluorocinnamide TIMTEC-BB SBB010203 ASINEX-REAG BAS 12820390 2-Fluorophenylpropionicacid 3-(2-fluorophenyl)propanoate 2-Fluoro-benzenepropanoic acid 3-(2-Fluorophenyl)propionicacid 3-(2-FLUOROPHENYL)PROPANOIC ACID 3-(2-Fluorophenyl)propionic acid 3-(2-FLUOROPHENYL)PROPRIONIC ACID 3-(2-Fluorophenyl)propionic acid, 2-Fluorohydrocinnamic acid |
| CAS | 1643-26-1 |
| InChI | InChI=1/C9H9FO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1 |
| InChIKey | GUZLQEOSDXLCKX-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO2 |
| Molar Mass | 168.16 |
| Density | 1.222±0.06 g/cm3(Predicted) |
| Melting Point | 74-78 °C |
| Boling Point | 273.7±15.0 °C(Predicted) |
| Flash Point | 119.3°C |
| Vapor Presure | 0.00275mmHg at 25°C |
| pKa | 4.65±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD01310820 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Hazard Note | Corrosive |
| Hazard Class | IRRITANT, CORROSIVE |