| Name | 3,4-Dihydroxy benzonitrile |
| Synonyms | AKOS B004053 4-CYANOCATECHOL TIMTEC-BB SBB008582 4-CYANOPYROCATECHOL Protocatachuonitrile PROTOCATECHUONITRILE Protocatachuonitrile 3,4-DIHYDROXYBENZONITRILE 3,4-Dihydroxy benzonitrile 3, 4-Dihydroxy benzonitrile BENZONITRILE, 3,4-DIHYDROXY- 4-CYANO-1,2-DIHYDROXYBENZENE |
| CAS | 17345-61-8 |
| EINECS | 241-367-9 |
| InChI | InChI=1/C7H5NO2/c8-4-5-1-2-6(9)7(10)3-5/h1-3,9-10H |
| InChIKey | NUWHYWYSMAPBHK-UHFFFAOYSA-N |
| Molecular Formula | C7H5NO2 |
| Molar Mass | 135.12 |
| Density | 1.42±0.1 g/cm3(Predicted) |
| Melting Point | 155-159 °C (lit.) |
| Boling Point | 334.8±32.0 °C(Predicted) |
| Flash Point | 156.3°C |
| Water Solubility | insoluble |
| Solubility | soluble in Methanol |
| Vapor Presure | 0Pa at 20℃ |
| Appearance | White crystalline powder |
| Color | White to Almost white |
| BRN | 2082204 |
| pKa | 7.67±0.18(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.647 |
| MDL | MFCD00016436 |
| Physical and Chemical Properties | Melting point 155-159°C(lit.) water-soluble insoluble BRN 2082204 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S36/37 - Wear suitable protective clothing and gloves. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S22 - Do not breathe dust. |
| UN IDs | UN3439 |
| WGK Germany | 3 |
| HS Code | 29269090 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
| LogP | 1.3 at 20℃ |
| use | as a pharmaceutical intermediate |