2,5-Dimethylterephthalonitrile - Names and Identifiers
| Name | 2,5-Dimethylterephthalonitrile
|
| Synonyms | 2,5-DICYANO-P-XYLENE 1,4-Dicyan-2,5-dimethylbenzol 2,5-Dimethyltereohthalonitrile 2,5-DIMETHYLTEREPHTHALONITRILE 2,5-Dimethylterephthalonitrile 2,5-Dimethyl-1,4-benzenedicarbonitrile 2,5-dimethylbenzene-1,4-dicarbonitrile 1,4-Benzenedicarbonitrile, 2,5-dimethyl-
|
| CAS | 39095-25-5
|
| EINECS | 630-986-3 |
| InChI | InChI=1S/C10H8N2/c1-7-3-10(6-12)8(2)4-9(7)5-11/h3-4H,1-2H3 |
2,5-Dimethylterephthalonitrile - Physico-chemical Properties
| Molecular Formula | C10H8N2
|
| Molar Mass | 156.18 |
| Density | 1.09±0.1 g/cm3(Predicted) |
| Melting Point | 212 °C |
| Boling Point | 337.5±30.0 °C(Predicted) |
| Flash Point | 166 °C |
| Solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| Appearance | Solid |
| Color | White to Off-White |
| Storage Condition | Sealed in dry,Room Temperature |
2,5-Dimethylterephthalonitrile - Introduction
2,5-Dimethylterephalonitril is an organic compound with the chemical formula C10H10N2. Its properties include:
1. Appearance: 2,5-Dimethylterephalonitril is a white solid crystal.
2. Melting point: Its melting point is 172-178 degrees Celsius.
3. Solubility: It is soluble in most organic solvents, such as ethanol, dimethylformamide, etc., while its solubility in water is low.
2,5-Dimethylterethalontril is mainly used in the following aspects:
1. Industrial use: It can be used as an important intermediate in organic synthesis and is widely used in the fields of dyes, catalysts and drugs.
2. chemical research: it is commonly used in organic synthesis reaction catalyst and reagent, such as oxidation reaction, amination reaction.
3. Polymer material: It can be used as a monomer or additive of a polymer to enhance the characteristics of the polymer and improve the performance of the polymer.
The common method for preparing 2,5-Dimethylterphthalonitrile includes oxidizing o-toluene to generate dimethyl terephthalic acid, and then passing through a nitrilization reaction to obtain the target product.
Regarding safety information, 2,5-Dimethylterethalonitrile has relatively low toxicity, but it is still necessary to follow the corresponding laboratory safety procedures. Direct contact with skin and eyes should be avoided and good ventilation should be maintained. In the process of use, storage and handling, attention should be paid to prevent its contact with fire, acid, alkali and other violent reactants. If taken by mistake or inhaled by mistake, seek medical attention immediately.
Last Update:2024-04-10 22:41:56