| Name | 2-Hydroxy-3-methoxy-5-nitrobenzaldehyde |
| Synonyms | AKOS B029200 5-NITRO-O-VANILLIN 3-METHOXY-5-NITROSALICYLADEHYDE 3-Methoxy-5-nitrosalicylaldehyde 3-METHOXY-5-NITROSALICYLALDEHYDE 2-formyl-6-methoxy-4-nitrophenolate 2-HYDROXY-3-METHOXY-5-NITROBENZALDEHYDE 2-Hydroxy-3-methoxy-5-nitrobenzaldehyde benzaldehyde, 2-hydroxy-3-methoxy-5-nitro- 2-Hydroxy-3-methoxy-5-nitrobenzaldehyde3-Methoxy-5-nitrosalicylaldehyde5-Nitro-o-vanillin |
| CAS | 17028-61-4 |
| EINECS | 626-668-9 |
| InChI | InChI=1/C8H7NO5/c1-14-7-3-6(9(12)13)2-5(4-10)8(7)11/h2-4,11H,1H3/p-1 |
| Molecular Formula | C8H7NO5 |
| Molar Mass | 197.14 |
| Density | 1.456 |
| Melting Point | 141-143 °C (lit.) |
| Boling Point | 344.0±42.0 °C(Predicted) |
| Flash Point | 161.8°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 3.41E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light orange to Yellow to Green |
| BRN | 613271 |
| pKa | 5.08±0.44(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Sensitive | Air Sensitive |
| MDL | MFCD00017033 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |