| Name | 2-Mercapto-5-methoxybenzothiazole |
| Synonyms | 5-Methoxybenzothiazole-2-thiol 5-METHOXYBENZOTHIAZOLE-2-THIOL 5-Methoxy-2-benzothiazolethiol 2-Mercapto-5-methoxybenzothiazole 2-MERCAPTO-5-METHOXYBENZOTHIAZOLE 5-Methoxy-2-mercaptobenzothiazole 5-methoxybenzothiazole-2(3H)-thione 5-Methoxy-2(3H)-benzothiazolethione 5-methoxy-1,3-benzothiazole-2(3H)-thione 2(3H)-Benzothiazolethione,5-methoxy-(9CI) |
| CAS | 55690-60-3 |
| EINECS | 259-755-1 |
| InChI | InChI=1/C8H7NOS2/c1-10-5-2-3-7-6(4-5)9-8(11)12-7/h2-4H,1H3,(H,9,11) |
| Molecular Formula | C8H7NOS2 |
| Molar Mass | 197.28 |
| Density | 1.44±0.1 g/cm3(Predicted) |
| Melting Point | 190-193°C |
| Boling Point | 340.8±44.0 °C(Predicted) |
| Flash Point | 159.9°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 8.38E-05mmHg at 25°C |
| BRN | 142225 |
| pKa | 9.27±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.728 |
| MDL | MFCD00185941 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| Hazard Class | IRRITANT |