| Name | 2-Methyl-2-hexenoic acid |
| Synonyms | 2-Methyl-2-hexenoic RARECHEM AL BM 0162 2-methyl-2-hexenoicaci 2-Methyl-2-hexenoic acid 2-Methylhex-2-enoic acid 2-METHYL-2-HEXENOIC ACID 2-methylhex-2-enoic acid (2E)-2-methylhex-2-enoate 2-Hexenoic acid, 2-methyl- (2E)-2-methylhex-2-enoic acid |
| CAS | 28897-58-7 |
| EINECS | 249-294-4 |
| InChI | InChI=1/C7H12O2/c1-3-4-5-6(2)7(8)9/h5H,3-4H2,1-2H3,(H,8,9)/p-1/b6-5+ |
| Molecular Formula | C7H12O2 |
| Molar Mass | 128.17 |
| Density | 0.97 |
| Melting Point | -9.25°C (estimate) |
| Boling Point | 89 °C / 1mmHg |
| Flash Point | 86°C |
| Vapor Presure | 0.105mmHg at 25°C |
| Refractive Index | 1.4273 (estimate) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R34 - Causes burns R36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 3265 |
| TSCA | Yes |
| Hazard Class | 8 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |