| Name | 2,6-Dimethoxy Acetophenone |
| Synonyms | USAF K-2801 2,6-Methoxy Acetophenone 2,6-DIMETHOXYACETOPHENONE 2,6-Dimethoxyacetophenone 2,6-Dimethoxy Acetophenone 2',6'-dimethoxy-acetophenon 2',6'-DIMETHOXYACETOPHENONE 2',6'-Dimethoxyacetophenone Acetophenone, 2',6'-dimethoxy- 1-(2,6-dimethoxyphenyl)ethanone 1-(2,6-dimethoxyphenyl)-ethanon 1-(2,6-DIMETHOXYPHENYL)ETHANONE Ethanone, 1-(2,6-dimethoxyphenyl)- |
| CAS | 2040-04-2 |
| EINECS | 218-034-1 |
| InChI | InChI=1/C10H12O3/c1-7(11)10-8(12-2)5-4-6-9(10)13-3/h4-6H,1-3H3 |
| Molecular Formula | C10H12O3 |
| Molar Mass | 180.2 |
| Density | 1.1272 (rough estimate) |
| Melting Point | 68-70°C(lit.) |
| Boling Point | 135-136°C2mm Hg(lit.) |
| Flash Point | 135-136°C/2mm |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.000488mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | White to beige |
| Maximum wavelength(λmax) | ['265nm(H2O)(lit.)'] |
| BRN | 2048976 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5430 (estimate) |
| MDL | MFCD00008729 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | AM8400000 |
| HS Code | 29145000 |
| Hazard Class | IRRITANT |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |