| Name | 4-(2-Keto-1-benzimidazolinyl)piperidine |
| Synonyms | 4-(2-oxobenzimidazolin-1-yl)piperidine 4-(2-Keto-1-benzimidazolinyl)piperidine 4-(2-Keto-1-benzimidozolinyl)-piperidine 1-(4-piperidyl)-1H-benzimidazol-2(3H)-one 1,3-Dihydro-1-(4-piperidinyl)-2H-benzimidazol-2-one 1-(piperidin-4-yl)-1,3-dihydro-2H-benzimidazol-2-one 4-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)piperidinium |
| CAS | 20662-53-7 |
| EINECS | 243-950-3 |
| InChI | InChI=1/C12H15N3O/c16-12-14-10-3-1-2-4-11(10)15(12)9-5-7-13-8-6-9/h1-4,9,13H,5-8H2,(H,14,16)/p+1 |
| InChIKey | BYNBAMHAURJNTR-UHFFFAOYSA-N |
| Molecular Formula | C12H15N3O |
| Molar Mass | 217.27 |
| Density | 1.1005 (rough estimate) |
| Melting Point | 183-185℃ |
| Boling Point | 357.82°C (rough estimate) |
| Appearance | Form Powder, color Off-white to slightly yellow |
| pKa | 12.06±0.30(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.5290 (estimate) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29333999 |