| Name | 4-bromo-2,1,3-benzothiadiazole |
| Synonyms | BT-BR AKOS BBS-00002903 IFLAB-BB F1918-0061 4-BROMO-2,1,3-BENZOTHIAZOLE 4-Bromobenzo[2,1,3]thiadiazole 4-bromo-2,1,3-benzothiadiazole 4-BROMO-2,1,3-BENZOTHIADIAZOLE 4-Bromo-benzo[1,2,5]thiadiazole 4-BroMobenzo[c][1,2,5]thiadiazole |
| CAS | 22034-13-5 |
| EINECS | 1533716-785-6 |
| InChI | InChI=1/C6H3BrN2S/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H |
| Molecular Formula | C6H3BrN2S |
| Molar Mass | 215.07 |
| Density | 1.859±0.06 g/cm3(Predicted) |
| Melting Point | 80 °C |
| Boling Point | 272.2±13.0 °C(Predicted) |
| Flash Point | 118.4°C |
| Vapor Presure | 0.0103mmHg at 25°C |
| pKa | -1.02±0.45(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.733 |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| use | 4-bromo-2, 1,3-benzothiadiazole is a heterocyclic organic compound and can be used as a pharmaceutical intermediate. |