| Name | 6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride |
| Synonyms | TIMTEC-BB SBB003285 LABOTEST-BB LT00453025 6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinolineHCl 1,2,3,4-tetrahydro-6,7-dimethoxy-isoquinolinhydrochloride 6,7-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE 6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride 1,2,3,4-TETRAHYDRO-6,7-DIMETHOXY-ISOQUINOLINE HYDROCHLORIDE 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolinium hydrochloride ISOQUINOLINE, 1,2,3,4-TETRAHYDRO-6,7-DIMETHOXY-, HYDROCHLORIDE |
| CAS | 2328-12-3 |
| EINECS | 607-218-0 |
| InChI | InChI=1/C11H15NO2/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2/h5-6,12H,3-4,7H2,1-2H3/p+1 |
| InChIKey | SHOWAGCIRTUYNA-UHFFFAOYSA-N |
| Molecular Formula | C11H16ClNO2 |
| Molar Mass | 229.7 |
| Melting Point | 260-265°C(lit.) |
| Boling Point | 314.9°C at 760 mmHg |
| Flash Point | 124.7°C |
| Solubility | soluble25mg/mL, clear, colorless (1N NaOH in methanol) |
| Vapor Presure | 0.000451mmHg at 25°C |
| Appearance | Solid |
| Color | White to slightly beige |
| BRN | 3634126 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| MDL | MFCD00012744 |
| Use | Raw materials for the synthesis of more complex isoquinoline and quinolinidine. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | NX5017980 |
| HS Code | 29334900 |
| Hazard Class | IRRITANT |
| Use | Raw materials for the synthesis of more complex isoquinoline and quinolinidine. |