| Name | cis-5-dodecenoic acid |
| Synonyms | 5-Dodecenoic acid CIS-5-DECENOICACID CIS-5-DODECENOIC ACID (Z)-5-Dodecenoic acid cis-5-dodecenoic acid (Z)-dodec-5-enoic acid (5Z)-5-dodecenoic acid 5-Dodecenoic acid, (5Z)- |
| CAS | 2430-94-6 |
| InChI | InChI=1/C18H22O4/c1-18-5-4-11-10-3-2-9(19)6-13(10)15(20)7-12(11)14(18)8-16(21)17(18)22/h2-3,6,11-12,14,16-17,19,21-22H,4-5,7-8H2,1H3/t11-,12-,14+,16-,17+,18+/m1/s1 |
| Molecular Formula | C12H22O2 |
| Molar Mass | 198.3 |
| Density | 0.906g/mLat 25°C(lit.) |
| Melting Point | 9.63°C (estimate) |
| Boling Point | 135°C0.4mm Hg(lit.) |
| Specific Rotation(α) | n20/D 1.454 (lit.) |
| Flash Point | >230°F |
| Solubility | Insoluble in water |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Liquid |
| Color | Colourless |
| pKa | 4.77±0.10(Predicted) |
| Storage Condition | Amber Vial, Refrigerator |
| Stability | Light Sensitive |
| Refractive Index | n20/D 1.454(lit.) |
| MDL | MFCD00239341 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S23 - Do not breathe vapour. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |