| Name | 3,5-Dimethylisoxazole-4-carboxylic acid |
| Synonyms | AKOS PAO-1555 3,5-dimethylisoxazole-4-carboxylate diMethyl-1,2-oxazole-4-carboxylic acid 3,5-Dimethylisoxazole-4-carboxylic acid 3,5-DIMETHYL-4-ISOXAZOLECARBOXYLIC ACID 3,5-dimethyl-1,2-oxazole-4-carboxylic acid 3,5- two Methylisoxazole-4- carboxylic acid |
| CAS | 2510-36-3 |
| EINECS | 219-724-5 |
| InChI | InChI=1/C6H7NO3/c1-3-5(6(8)9)4(2)10-7-3/h1-2H3,(H,8,9)/p-1 |
| Molecular Formula | C6H7NO3 |
| Molar Mass | 141.12 |
| Density | 1.3710 (rough estimate) |
| Melting Point | 141-145°C(lit.) |
| Boling Point | 258.14°C (rough estimate) |
| Flash Point | 136.3°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.000455mmHg at 25°C |
| Appearance | Pale beige powder |
| Color | White to Almost white |
| BRN | 115819 |
| pKa | 2.53±0.32(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.4890 (estimate) |
| MDL | MFCD00051657 |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S22 - Do not breathe dust. |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Hazard Class | IRRITANT |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |