| Name | 5-Chloroindoline |
| Synonyms | 5-Chloroindoline 5-CHLOROINDOLINE TIMTEC-BB SBB010106 5-chloro-2,3-dihydro-indole 5-Chloro-2,3-dihydro-1H-indole 5-CHLORO-2,3-DIHYDRO-(1H)-INDOLE 1H-Indole, 5-chloro-2,3-dihydro- 5-Chloroindoline 5-Chloro-2,3-dihydro-(1H)-indole in stock Factory |
| CAS | 25658-80-4 |
| EINECS | 247-167-8 |
| InChI | InChI=1/C8H8ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5,10H,3-4H2 |
| Molecular Formula | C8H8ClN |
| Molar Mass | 153.61 |
| Density | 1.214±0.06 g/cm3(Predicted) |
| Boling Point | 93-98°C 0,3mm |
| Flash Point | 115.1°C |
| Vapor Presure | 0.00847mmHg at 25°C |
| pKa | 4.48±0.20(Predicted) |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.579 |
| Risk Codes | R25 - Toxic if swallowed R51 - Toxic to aquatic organisms |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN2811 |
| Hazard Note | Irritant |