| Name | 2-Bromo-6-methoxyphenol |
| Synonyms | 6-Bromoguaiacol 6-broMo-2-Methoxyphenol 2-Bromo-6-methoxyphenol 3-Bromo-2-hydroxyanisole 2-BROMO-6-METHOXY-PHENOL Phenol, 2-bromo-6-methoxy- |
| CAS | 28165-49-3 |
| InChI | InChI=1/C7H7BrO2/c1-10-6-4-2-3-5(8)7(6)9/h2-4,9H,1H3 |
| Molecular Formula | C7H7BrO2 |
| Molar Mass | 203.03 |
| Density | 1.585±0.06 g/cm3(Predicted) |
| Melting Point | 62-65°C |
| Boling Point | 146°C/4mmHg(lit.) |
| Flash Point | 86.5°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.081mmHg at 25°C |
| pKa | 8.43±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.578 |
| MDL | MFCD08146628 |
| Use | The application of 2-bromo-6-methoxyphenol can be used as an intermediate in organic synthesis and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37 - Wear suitable gloves. |
| HS Code | 29095000 |
| Hazard Class | IRRITANT |
| Raw Materials | 5-Bromo-2-methoxyphenol 2-BROMO-3-METHOXYPHENOL Guaiacol 2-Bromoanisole |
| Downstream Products | 3-BROMOBENZENE-1,2-DIOL |
| application | 2-bromo-6-methoxyphenol can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. |