| Name | 3,5-Dibenzyloxyacetophenone |
| Synonyms | Terbutaline Impurity 1 3,5-DIBENZYLOXYACETOPHENONE 3,5-Dibenzyloxyacetophenone 3',5'-DIBENZYLOXYACETPHENONE 3',5'-DIBENZYLOXYACETOPHENONE 3',5'-Dibenzyloxyacetophenone 3,5-bis(benzyloxy)acetophenone 3',5'-BIS(BENZYLOXY)ACETOPHENONE 1-[3,5-bis(benzyloxy)phenyl]ethanone 1-[3,5-Bis(benzyloxy)phenyl]ethan-1-one 1-[3,5-bis(phenylmethoxy)phenyl]-ethanon 3',5'-Dibenzyloxyacetophenone 3,5-Dibenzyloxyacetophenone |
| CAS | 28924-21-2 |
| EINECS | 249-315-7 |
| InChI | InChI=1/C22H20O3/c1-17(23)20-12-21(24-15-18-8-4-2-5-9-18)14-22(13-20)25-16-19-10-6-3-7-11-19/h2-14H,15-16H2,1H3 |
| InChIKey | KOJXGMJOTRYLBD-UHFFFAOYSA-N |
| Molecular Formula | C22H20O3 |
| Molar Mass | 332.39 |
| Density | 1.1079 (rough estimate) |
| Melting Point | 60-62 °C (lit.) |
| Boling Point | 429.52°C (rough estimate) |
| Flash Point | 242.1°C |
| Solubility | Soluble in dichloromethane, ethyl acetate and methanol |
| Vapor Presure | 9.94E-10mmHg at 25°C |
| Appearance | White crystal |
| Color | Off-White to Pale Yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.6000 (estimate) |
| MDL | MFCD00004777 |
| Physical and Chemical Properties | White crystalline powder, is a useful compound in organic synthesis. |
| Hazard Symbols | Xi - Irritant![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29145090 |
| Hazard Note | Irritant |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |