| Name | 3-Methoxybenzaldehyde |
| Synonyms | M-ANISALDEHYDE 3-ANISALDEHYDE AKOS BBS-00003247 META-ANISALDEHYDE 3-methoxybenzaldehde 3-Methoxybenzaldehyde M-METHOXYBENZALDEHYDE 3-methoxy-benzaldehyd Metamethoxybenzaldehyde |
| CAS | 591-31-1 |
| EINECS | 209-712-8 |
| InChI | InChI=1/C8H8O2/c1-10-8-4-2-3-7(5-8)6-9/h2-6H,1H3 |
| Molecular Formula | C8H8O2 |
| Molar Mass | 136.148 |
| Density | 1.088g/cm3 |
| Melting Point | 187 °C |
| Boling Point | 230.8°C at 760 mmHg |
| Flash Point | 100.2°C |
| Water Solubility | insoluble |
| Vapor Presure | 0.0647mmHg at 25°C |
| Refractive Index | 1.547 |
| Physical and Chemical Properties | Chemical properties colorless or yellowish oily liquid. Boiling point 230 ℃,125 ℃(4kPa),88-90 ℃(400Pa), relative density 1.1187(20/4 ℃), refractive index 1.5530(20 ℃). Soluble in alcohol, ether and benzene, insoluble in water. |
| Use | Uses fragrances, organic intermediates. Used as pharmaceutical intermediates, intermediates in organic synthesis. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/38 - Irritating to eyes and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| Vapor pressure | 1.3 hPa (73 °C) |
| refractive index | n20/D 1.553(lit.) |
| flash point | >230 °F |
| storage conditions | Store below 30°C. |
| morphology | Liquid |
| color | Clear pale yellow to yellow |
| Specific gravity | 1.118 |
| water solubility | insoluble |
| sensitivity | Air Sensitive |
| BRN | 606013 |
| NIST chemical information | Benzaldehyde, 3-methoxy-(591-31-1) |
| EPA chemical information | Benzaldehyde, 3-methoxy- (591-31-1) |
| WGK Germany | 3 |
| RTECS number | BZ2605000 |
| F | 9-23 |
| auto-ignition temperature | 225 °C |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| customs code | 29124900 |
| Toxicity | sce-hmn:lyms 1 mmol/L MUREAV 206,17,88 |
introduction
3-Methoxybenzaldehyde is a colorless or light yellow oily liquid. Solubility: insoluble in water, soluble in alcohol, ether, benzene.
application
3-methoxybenzaldehyde is widely used in chemical and chemical fields as chemical raw materials, organic intermediates and spices.
Preparation
The molar ratio of nitric acid to m-methoxybenzyl methanol is 1.5, and the mass ratio of water to m-methoxybenzyl methanol is 1; reduce the two bottles to below 5 degrees and then add m-methoxybenzyl methanol, start stirring, then add the pre-prepared nitric acid solution, after adding, the system returns to room temperature, TLC and liquid phase monitor the reaction, after about seven hours, add sodium hydroxide solution to the system, wash with water and saturated salt water, and dry with anhydrous magnesium sulfate. Decompression desolysis gives the product.
production method
It is obtained by the reaction of m-hydroxybenzaldehyde and dimethyl sulfate.
category
flammable liquids
toxicity classification
Poisoning
acute toxicity
Reference value: oral-rat LD50: 2500 mg/kg
flammability hazard characteristics
Flammable; combustion produces stimulating smoke
storage and transportation features
The warehouse is ventilated and dry at low temperature; stored separately from food ingredients
fire extinguishing agent
Dry powder, foam, sand, carbon dioxide, mist water