| Name | m-methylcinnamic acid |
| Synonyms | RARECHEM BK HC T306 m-Methylcinnamic acid 3-METHYLCINNAMIC ACID m-methylcinnamic acid 3-M-TOLYL-ACRYLIC ACID Cinnamic acid, m-methyl- 3-(3-METHYLPHENYL)-2-PROPENOIC ACID (2E)-3-(3-methylphenyl)prop-2-enoate 2-Propenoic acid, 3-(3-methylphenyl)- (2E)-3-(3-Methylphenyl)-2-propenoic acid |
| CAS | 3029-79-6 |
| EINECS | 221-199-2 |
| InChI | InChI=1/C10H10O2/c1-8-3-2-4-9(7-8)5-6-10(11)12/h2-7H,1H3,(H,11,12)/p-1/b6-5+ |
| Molecular Formula | C10H10O2 |
| Molar Mass | 162.19 |
| Density | 1.0281 (rough estimate) |
| Melting Point | 116 °C |
| Boling Point | 228.88°C (rough estimate) |
| Flash Point | 203.9°C |
| Vapor Presure | 0.000572mmHg at 25°C |
| Appearance | Solid |
| Color | White to Almost white |
| BRN | 2042550 |
| pKa | 4.44(at 25℃) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.5766 (estimate) |
| MDL | MFCD00016844 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. S22 - Do not breathe dust. |
| HS Code | 29163990 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| properties | m-methyl cinnamic acid is a white crystal, mp:116-119 ℃, insoluble in water, soluble in ethanol, ethyl acetate and other organic solvents. |
| use | m-methyl cinnamic acid can be used for daily chemical essence. |
| Preparation method | M-methylcinnamic acid is obtained by the reaction of m-methylbenzaldehyde and malonic acid. |