| Name | 6-methoxyflavanone |
| Synonyms | NSC 50184 6-METHOXYFLAVANONE 6-Methoxyflavanone 6-methoxyflavanone METHOXYFLAVANONE, 6- METHOXYFLAVANONE, 6-(P) 2-Phenyl-6-methoxychroman-4-one 2-Phenyl-6-methoxy-2H-1-benzopyran-4(3H)-one 6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one (2R)-6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one 2,3-Dihydro-6-methoxy-2-phenyl-4H-1-benzopyran-4-one 2-Phenyl-6-methoxy-2,3-dihydro-4H-1-benzopyran-4-one (2S)-6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one 4H-1-Benzopyran-4-one, 2,3-dihydro-6-methoxy-2-phenyl- |
| CAS | 3034-04-6 |
| EINECS | 000-000-0 |
| InChI | InChI=1/C16H14O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-9,16H,10H2,1H3/t16-/m1/s1 |
| Molecular Formula | C16H14O3 |
| Molar Mass | 254.28 |
| Density | 1.199±0.06 g/cm3(Predicted) |
| Melting Point | 141-143°C(lit.) |
| Boling Point | 425.5±45.0 °C(Predicted) |
| Flash Point | 202.9°C |
| Vapor Presure | 1.91E-07mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Yellow to Orange |
| BRN | 248912 |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.587 |
| MDL | MFCD00017484 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29329900 |