| Name | 2,6-Dibromo-4-fluoroaniline |
| Synonyms | 2,6-DIBROMO-4-FLUOROANLINE 2,6-Dibromo-4-Tluoroaniline 2,6-DIBROMO-4-FLUOROANILINE 2,6-Dibromo-4-fluoroaniline 2,6-Dichloro-4-fluoroaniline 1-AMINO-2,6-DIBROMO-4-FLUOROBENZENE benzenamine, 2,6-dichloro-4-fluoro- 4'-fluoro-[1,1'-biphenyl]-2-carbonitrile |
| CAS | 344-18-3 |
| InChI | InChI=1/C6H4Cl2FN/c7-4-1-3(9)2-5(8)6(4)10/h1-2H,10H2 |
| Molecular Formula | C6H4Br2FN |
| Molar Mass | 268.91 |
| Density | 2.0271 (rough estimate) |
| Melting Point | 64-66 °C (lit.) |
| Boling Point | 265.2±35.0 °C(Predicted) |
| Flash Point | 84.8°C |
| Vapor Presure | 0.139mmHg at 25°C |
| Appearance | Grey-purple to brown crystals |
| BRN | 3246923 |
| pKa | 0.54±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.4640 (estimate) |
| MDL | MFCD00041445 |
| Physical and Chemical Properties | Brown solid. Melting point 64 ℃-66 ℃. |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN2811 |
| WGK Germany | 3 |
| HS Code | 29214200 |
| Hazard Note | Toxic |
| Hazard Class | 6.1 |
| Packing Group | III |
| Chemical properties | brown solid. Melting Point 64-66 °c. |
| Use | Pharmaceutical, pesticide, liquid crystal material intermediates. |