| Name | 2,3,4,6-tetrafluoroaniline |
| Synonyms | 2,3,4,6-TETRAFLUOROA 4-fluro-2-methylaniline 2,3,4,6-tetrafluoroaniline 2,3,4,6-TETRAFLUOROANILINE (2,3,4,6-tetrafluorophenyl)amine Benzenamine, 2,3,4,6-tetrafluoro- naphtho[2,3-g][2,1]benzoxazole-6,11-dione |
| CAS | 363-73-5 |
| EINECS | 206-659-2 |
| InChI | InChI=1/C6H3F4N/c7-2-1-3(8)6(11)5(10)4(2)9/h1H,11H2 |
| Molecular Formula | C6H3F4N |
| Molar Mass | 165.09 |
| Density | 1.5g/mLat 25°C(lit.) |
| Melting Point | 23-26 |
| Boling Point | 65°C20mm Hg(lit.) |
| Flash Point | 136°F |
| Vapor Presure | 2.02mmHg at 25°C |
| pKa | 0.85±0.10(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | n20/D 1.462(lit.) |
| Physical and Chemical Properties | Boiling point of 65 degrees C (20mmHg), flash point of 57 degrees C, refractive index of 1.4620, specific gravity of 1.500. |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| Hazard Class | 3.2 |
| Packing Group | III |
| uses | intermediates in medicine, pesticides and liquid crystal materials. |